C21H35N3OS — CID 19831115
2-[2-(dimethylamino)ethyl]-5-nonyl-2-pyridin-3-yl-1,3-thiazolidin-4-one (PubChem CID 19831115) has the molecular formula C21H35N3OS and a molecular weight of 377.60 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethyl]-5-nonyl-2-pyridin-3-yl-1,3-thiazolidin-4-one.
| Compound Name | 2-[2-(dimethylamino)ethyl]-5-nonyl-2-pyridin-3-yl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 19831115 |
| Molecular Formula | C21H35N3OS |
| Molecular Weight | 377.60 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | 2-[2-(dimethylamino)ethyl]-5-nonyl-2-pyridin-3-yl-1,3-thiazolidin-4-one |
| SMILES | CCCCCCCCCC1SC(CCN(C)C)(c2cccnc2)NC1=O |
| InChI | InChI=1S/C21H35N3OS/c1-4-5-6-7-8-9-10-13-19-20(25)23-21(26-19,14-16-24(2)3)18-12-11-15-22-17-18/h11-12,15,17,19H,4-10,13-14,16H2,1-3H3,(H,23,25) |
| InChIKey | BIIOOOVJDFZBAD-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.60 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|