C24H42N2O2 — CID 67864533
3-[(2S)-1-methylpyrrolidin-2-yl]pyridine;tetradecanoic acid (PubChem CID 67864533) has the molecular formula C24H42N2O2 and a molecular weight of 390.61 g/mol. Its IUPAC name is 3-[(2S)-1-methylpyrrolidin-2-yl]pyridine;tetradecanoic acid.
| Compound Name | 3-[(2S)-1-methylpyrrolidin-2-yl]pyridine;tetradecanoic acid |
|---|---|
| PubChem CID | 67864533 |
| Molecular Formula | C24H42N2O2 |
| Molecular Weight | 390.61 g/mol |
| Exact Mass | 390.32 |
| IUPAC Name | 3-[(2S)-1-methylpyrrolidin-2-yl]pyridine;tetradecanoic acid |
| SMILES | CCCCCCCCCCCCCC(=O)O.CN1CCC[C@H]1c1cccnc1 |
| InChI | InChI=1S/C14H28O2.C10H14N2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16;1-12-7-3-5-10(12)9-4-2-6-11-8-9/h2-13H2,1H3,(H,15,16);2,4,6,8,10H,3,5,7H2,1H3/t;10-/m.0/s1 |
| InChIKey | GPDPQNUEHLJMGV-CICJTZRQSA-N |
| XLogP | 6.62 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.61 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|