C15H22N2O4 — CID 174471430
4-methoxy-4-oxobutanoic acid;3-(1-methylpyrrolidin-2-yl)pyridine (PubChem CID 174471430) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is 4-methoxy-4-oxobutanoic acid;3-(1-methylpyrrolidin-2-yl)pyridine.
| Compound Name | 4-methoxy-4-oxobutanoic acid;3-(1-methylpyrrolidin-2-yl)pyridine |
|---|---|
| PubChem CID | 174471430 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 4-methoxy-4-oxobutanoic acid;3-(1-methylpyrrolidin-2-yl)pyridine |
| SMILES | CN1CCCC1c1cccnc1.COC(=O)CCC(=O)O |
| InChI | InChI=1S/C10H14N2.C5H8O4/c1-12-7-3-5-10(12)9-4-2-6-11-8-9;1-9-5(8)3-2-4(6)7/h2,4,6,8,10H,3,5,7H2,1H3;2-3H2,1H3,(H,6,7) |
| InChIKey | QYAIPQKSGALEIJ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |