About 6-tert-butyl-5-propan-2-yl-3,4-dihydro-2H-1,4-thiazine
6-tert-butyl-5-propan-2-yl-3,4-dihydro-2H-1,4-thiazine (PubChem CID 146492253) has the molecular formula C11H21NS
and a molecular weight of 199.36 g/mol. Its IUPAC name is 6-tert-butyl-5-propan-2-yl-3,4-dihydro-2H-1,4-thiazine.
Molecular Properties
| Compound Name | 6-tert-butyl-5-propan-2-yl-3,4-dihydro-2H-1,4-thiazine |
| PubChem CID | 146492253 |
| Molecular Formula | C11H21NS |
| Molecular Weight | 199.36 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | 6-tert-butyl-5-propan-2-yl-3,4-dihydro-2H-1,4-thiazine |
| SMILES | CC(C)C1=C(C(C)(C)C)SCCN1 |
| InChI | InChI=1S/C11H21NS/c1-8(2)9-10(11(3,4)5)13-7-6-12-9/h8,12H,6-7H2,1-5H3 |
| InChIKey | RCFUGOKVVJQBIZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.36 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-tert-butyl-5-propan-2-yl-3,4-dihydro-2H-1,4-thiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butyl-5-propan-2-yl-3,4-dihydro-2H-1,4-thiazine?
The IUPAC name of 6-tert-butyl-5-propan-2-yl-3,4-dihydro-2H-1,4-thiazine (CID 146492253) is 6-tert-butyl-5-propan-2-yl-3,4-dihydro-2H-1,4-thiazine.
What is the SMILES notation for 6-tert-butyl-5-propan-2-yl-3,4-dihydro-2H-1,4-thiazine?
The canonical SMILES for 6-tert-butyl-5-propan-2-yl-3,4-dihydro-2H-1,4-thiazine is CC(C)C1=C(C(C)(C)C)SCCN1.
What is the InChIKey of 6-tert-butyl-5-propan-2-yl-3,4-dihydro-2H-1,4-thiazine?
The InChIKey is RCFUGOKVVJQBIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NS/c1-8(2)9-10(11(3,4)5)13-7-6-12-9/h8,12H,6-7H2,1-5H3.
What are the key properties of 6-tert-butyl-5-propan-2-yl-3,4-dihydro-2H-1,4-thiazine?
6-tert-butyl-5-propan-2-yl-3,4-dihydro-2H-1,4-thiazine has a molecular weight of 199.36 g/mol, XLogP of 3.24, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butyl-5-propan-2-yl-3,4-dihydro-2H-1,4-thiazine is sourced from PubChem (CID 146492253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).