C13H15F7O3 — CID 146493161
[2,3,4,4-tetramethyl-5,5-bis(trifluoromethyl)oxolan-2-yl] 2-fluoroprop-2-enoate (PubChem CID 146493161) has the molecular formula C13H15F7O3 and a molecular weight of 352.25 g/mol. Its IUPAC name is [2,3,4,4-tetramethyl-5,5-bis(trifluoromethyl)oxolan-2-yl] 2-fluoroprop-2-enoate.
| Compound Name | [2,3,4,4-tetramethyl-5,5-bis(trifluoromethyl)oxolan-2-yl] 2-fluoroprop-2-enoate |
|---|---|
| PubChem CID | 146493161 |
| Molecular Formula | C13H15F7O3 |
| Molecular Weight | 352.25 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | [2,3,4,4-tetramethyl-5,5-bis(trifluoromethyl)oxolan-2-yl] 2-fluoroprop-2-enoate |
| SMILES | C=C(F)C(=O)OC1(C)OC(C(F)(F)F)(C(F)(F)F)C(C)(C)C1C |
| InChI | InChI=1S/C13H15F7O3/c1-6(14)8(21)22-10(5)7(2)9(3,4)11(23-10,12(15,16)17)13(18,19)20/h7H,1H2,2-5H3 |
| InChIKey | BVGQZSRVUBBMMP-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.25 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|