C18H15N5O2 — CID 14650343
2-[[3-(2H-tetrazol-5-ylmethoxy)phenoxy]methyl]quinoline (PubChem CID 14650343) has the molecular formula C18H15N5O2 and a molecular weight of 333.35 g/mol. Its IUPAC name is 2-[[3-(2H-tetrazol-5-ylmethoxy)phenoxy]methyl]quinoline.
| Compound Name | 2-[[3-(2H-tetrazol-5-ylmethoxy)phenoxy]methyl]quinoline |
|---|---|
| PubChem CID | 14650343 |
| Molecular Formula | C18H15N5O2 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 2-[[3-(2H-tetrazol-5-ylmethoxy)phenoxy]methyl]quinoline |
| SMILES | c1cc(OCc2ccc3ccccc3n2)cc(OCc2nn[nH]n2)c1 |
| InChI | InChI=1S/C18H15N5O2/c1-2-7-17-13(4-1)8-9-14(19-17)11-24-15-5-3-6-16(10-15)25-12-18-20-22-23-21-18/h1-10H,11-12H2,(H,20,21,22,23) |
| InChIKey | FOTHBOISNKWERK-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |