C27H23N5O — CID 15157915
2-[[4-[(E)-2-[4-[2-(2H-tetrazol-5-yl)ethyl]phenyl]ethenyl]phenoxy]methyl]quinoline (PubChem CID 15157915) has the molecular formula C27H23N5O and a molecular weight of 433.52 g/mol. Its IUPAC name is 2-[[4-[(E)-2-[4-[2-(2H-tetrazol-5-yl)ethyl]phenyl]ethenyl]phenoxy]methyl]quinoline.
| Compound Name | 2-[[4-[(E)-2-[4-[2-(2H-tetrazol-5-yl)ethyl]phenyl]ethenyl]phenoxy]methyl]quinoline |
|---|---|
| PubChem CID | 15157915 |
| Molecular Formula | C27H23N5O |
| Molecular Weight | 433.52 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | 2-[[4-[(E)-2-[4-[2-(2H-tetrazol-5-yl)ethyl]phenyl]ethenyl]phenoxy]methyl]quinoline |
| SMILES | C(=C/c1ccc(OCc2ccc3ccccc3n2)cc1)\c1ccc(CCc2nn[nH]n2)cc1 |
| InChI | InChI=1S/C27H23N5O/c1-2-4-26-23(3-1)14-15-24(28-26)19-33-25-16-11-22(12-17-25)10-7-20-5-8-21(9-6-20)13-18-27-29-31-32-30-27/h1-12,14-17H,13,18-19H2,(H,29,30,31,32)/b10-7+ |
| InChIKey | RRXWGJIIGQYMFS-JXMROGBWSA-N |
| XLogP | 5.28 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.52 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|