C27H22ClN5O — CID 19808987
2-[[3-[(E)-2-[4-[(E)-2-(2H-tetrazol-5-yl)ethenyl]phenyl]ethenyl]phenoxy]methyl]quinoline;hydrochloride (PubChem CID 19808987) has the molecular formula C27H22ClN5O and a molecular weight of 467.96 g/mol. Its IUPAC name is 2-[[3-[(E)-2-[4-[(E)-2-(2H-tetrazol-5-yl)ethenyl]phenyl]ethenyl]phenoxy]methyl]quinoline;hydrochloride.
| Compound Name | 2-[[3-[(E)-2-[4-[(E)-2-(2H-tetrazol-5-yl)ethenyl]phenyl]ethenyl]phenoxy]methyl]quinoline;hydrochloride |
|---|---|
| PubChem CID | 19808987 |
| Molecular Formula | C27H22ClN5O |
| Molecular Weight | 467.96 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | 2-[[3-[(E)-2-[4-[(E)-2-(2H-tetrazol-5-yl)ethenyl]phenyl]ethenyl]phenoxy]methyl]quinoline;hydrochloride |
| SMILES | C(=C/c1cccc(OCc2ccc3ccccc3n2)c1)\c1ccc(/C=C/c2nn[nH]n2)cc1.Cl |
| InChI | InChI=1S/C27H21N5O.ClH/c1-2-7-26-23(5-1)15-16-24(28-26)19-33-25-6-3-4-22(18-25)13-12-20-8-10-21(11-9-20)14-17-27-29-31-32-30-27;/h1-18H,19H2,(H,29,30,31,32);1H/b13-12+,17-14+; |
| InChIKey | VXXGCZICSNUTJV-LCLOFOHASA-N |
| XLogP | 6.09 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.96 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|