C26H21N5O2 — CID 19808901
2-[[4-[(E)-2-[4-(2H-tetrazol-5-ylmethoxy)phenyl]ethenyl]phenoxy]methyl]quinoline (PubChem CID 19808901) has the molecular formula C26H21N5O2 and a molecular weight of 435.49 g/mol. Its IUPAC name is 2-[[4-[(E)-2-[4-(2H-tetrazol-5-ylmethoxy)phenyl]ethenyl]phenoxy]methyl]quinoline.
| Compound Name | 2-[[4-[(E)-2-[4-(2H-tetrazol-5-ylmethoxy)phenyl]ethenyl]phenoxy]methyl]quinoline |
|---|---|
| PubChem CID | 19808901 |
| Molecular Formula | C26H21N5O2 |
| Molecular Weight | 435.49 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 2-[[4-[(E)-2-[4-(2H-tetrazol-5-ylmethoxy)phenyl]ethenyl]phenoxy]methyl]quinoline |
| SMILES | C(=C/c1ccc(OCc2nn[nH]n2)cc1)\c1ccc(OCc2ccc3ccccc3n2)cc1 |
| InChI | InChI=1S/C26H21N5O2/c1-2-4-25-21(3-1)11-12-22(27-25)17-32-23-13-7-19(8-14-23)5-6-20-9-15-24(16-10-20)33-18-26-28-30-31-29-26/h1-16H,17-18H2,(H,28,29,30,31)/b6-5+ |
| InChIKey | QERPJUIAJQMZJW-AATRIKPKSA-N |
| XLogP | 5.08 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.49 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|