C15H19N5O4 — CID 146504170
tert-butyl 3-[(5-cyano-2-formyl-3-methylimidazole-4-carbonyl)amino]azetidine-1-carboxylate (PubChem CID 146504170) has the molecular formula C15H19N5O4 and a molecular weight of 333.35 g/mol. Its IUPAC name is tert-butyl 3-[(5-cyano-2-formyl-3-methylimidazole-4-carbonyl)amino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(5-cyano-2-formyl-3-methylimidazole-4-carbonyl)amino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 146504170 |
| Molecular Formula | C15H19N5O4 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | tert-butyl 3-[(5-cyano-2-formyl-3-methylimidazole-4-carbonyl)amino]azetidine-1-carboxylate |
| SMILES | Cn1c(C=O)nc(C#N)c1C(=O)NC1CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C15H19N5O4/c1-15(2,3)24-14(23)20-6-9(7-20)17-13(22)12-10(5-16)18-11(8-21)19(12)4/h8-9H,6-7H2,1-4H3,(H,17,22) |
| InChIKey | CTNZLQYELLUQHQ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 117.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|