C16H23N3O4 — CID 163713387
tert-butyl 3-[2-(2-formyl-3,5-dimethylimidazol-4-yl)-2-oxoethyl]azetidine-1-carboxylate (PubChem CID 163713387) has the molecular formula C16H23N3O4 and a molecular weight of 321.38 g/mol. Its IUPAC name is tert-butyl 3-[2-(2-formyl-3,5-dimethylimidazol-4-yl)-2-oxoethyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[2-(2-formyl-3,5-dimethylimidazol-4-yl)-2-oxoethyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 163713387 |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | tert-butyl 3-[2-(2-formyl-3,5-dimethylimidazol-4-yl)-2-oxoethyl]azetidine-1-carboxylate |
| SMILES | Cc1nc(C=O)n(C)c1C(=O)CC1CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C16H23N3O4/c1-10-14(18(5)13(9-20)17-10)12(21)6-11-7-19(8-11)15(22)23-16(2,3)4/h9,11H,6-8H2,1-5H3 |
| InChIKey | KLEWCCUGCFZQKB-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|