About N-diazenyl-N,3-dimethylbutan-2-amine
N-diazenyl-N,3-dimethylbutan-2-amine (PubChem CID 146507208) has the molecular formula C6H15N3
and a molecular weight of 129.21 g/mol. Its IUPAC name is N-diazenyl-N,3-dimethylbutan-2-amine.
Molecular Properties
| Compound Name | N-diazenyl-N,3-dimethylbutan-2-amine |
| PubChem CID | 146507208 |
| Molecular Formula | C6H15N3 |
| Molecular Weight | 129.21 g/mol |
| Exact Mass | 129.13 |
| IUPAC Name | N-diazenyl-N,3-dimethylbutan-2-amine |
| SMILES | [H]/N=N/N(C)C(C)C(C)C |
| InChI | InChI=1S/C6H15N3/c1-5(2)6(3)9(4)8-7/h5-7H,1-4H3/b8-7+ |
| InChIKey | RHDNNIYCRUNXGM-BQYQJAHWSA-N |
| XLogP | 1.91 |
| TPSA | 39.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.21 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-diazenyl-N,3-dimethylbutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-diazenyl-N,3-dimethylbutan-2-amine?
The IUPAC name of N-diazenyl-N,3-dimethylbutan-2-amine (CID 146507208) is N-diazenyl-N,3-dimethylbutan-2-amine.
What is the SMILES notation for N-diazenyl-N,3-dimethylbutan-2-amine?
The canonical SMILES for N-diazenyl-N,3-dimethylbutan-2-amine is [H]/N=N/N(C)C(C)C(C)C.
What is the InChIKey of N-diazenyl-N,3-dimethylbutan-2-amine?
The InChIKey is RHDNNIYCRUNXGM-BQYQJAHWSA-N. The full InChI is InChI=1S/C6H15N3/c1-5(2)6(3)9(4)8-7/h5-7H,1-4H3/b8-7+.
What are the key properties of N-diazenyl-N,3-dimethylbutan-2-amine?
N-diazenyl-N,3-dimethylbutan-2-amine has a molecular weight of 129.21 g/mol, XLogP of 1.91, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-diazenyl-N,3-dimethylbutan-2-amine is sourced from PubChem (CID 146507208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).