C33H44O6 — CID 146507364
3,6,6-trimethylheptyl 2-[10-[2-(2-methylbutan-2-yloxy)-2-oxoethoxy]anthracen-9-yl]oxyacetate (PubChem CID 146507364) has the molecular formula C33H44O6 and a molecular weight of 536.71 g/mol. Its IUPAC name is 3,6,6-trimethylheptyl 2-[10-[2-(2-methylbutan-2-yloxy)-2-oxoethoxy]anthracen-9-yl]oxyacetate.
| Compound Name | 3,6,6-trimethylheptyl 2-[10-[2-(2-methylbutan-2-yloxy)-2-oxoethoxy]anthracen-9-yl]oxyacetate |
|---|---|
| PubChem CID | 146507364 |
| Molecular Formula | C33H44O6 |
| Molecular Weight | 536.71 g/mol |
| Exact Mass | 536.31 |
| IUPAC Name | 3,6,6-trimethylheptyl 2-[10-[2-(2-methylbutan-2-yloxy)-2-oxoethoxy]anthracen-9-yl]oxyacetate |
| SMILES | CCC(C)(C)OC(=O)COc1c2ccccc2c(OCC(=O)OCCC(C)CCC(C)(C)C)c2ccccc12 |
| InChI | InChI=1S/C33H44O6/c1-8-33(6,7)39-29(35)22-38-31-26-15-11-9-13-24(26)30(25-14-10-12-16-27(25)31)37-21-28(34)36-20-18-23(2)17-19-32(3,4)5/h9-16,23H,8,17-22H2,1-7H3 |
| InChIKey | RJWLZFYZNFJTAM-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.71 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|