C22H18ClF4N5O2 — CID 146509058
N-[4-[chloro(difluoro)methoxy]phenyl]-1-(2,2-difluoroethyl)-7-[(E)-1-[(methylideneamino)methylideneamino]prop-1-en-2-yl]benzimidazole-5-carboxamide (PubChem CID 146509058) has the molecular formula C22H18ClF4N5O2 and a molecular weight of 495.86 g/mol. Its IUPAC name is N-[4-[chloro(difluoro)methoxy]phenyl]-1-(2,2-difluoroethyl)-7-[(E)-1-[(methylideneamino)methylideneamino]prop-1-en-2-yl]benzimidazole-5-carboxamide.
| Compound Name | N-[4-[chloro(difluoro)methoxy]phenyl]-1-(2,2-difluoroethyl)-7-[(E)-1-[(methylideneamino)methylideneamino]prop-1-en-2-yl]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 146509058 |
| Molecular Formula | C22H18ClF4N5O2 |
| Molecular Weight | 495.86 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | N-[4-[chloro(difluoro)methoxy]phenyl]-1-(2,2-difluoroethyl)-7-[(E)-1-[(methylideneamino)methylideneamino]prop-1-en-2-yl]benzimidazole-5-carboxamide |
| SMILES | C=N/C=N/C=C(\C)c1cc(C(=O)Nc2ccc(OC(F)(F)Cl)cc2)cc2ncn(CC(F)F)c12 |
| InChI | InChI=1S/C22H18ClF4N5O2/c1-13(9-29-11-28-2)17-7-14(8-18-20(17)32(12-30-18)10-19(24)25)21(33)31-15-3-5-16(6-4-15)34-22(23,26)27/h3-9,11-12,19H,2,10H2,1H3,(H,31,33)/b13-9+,29-11+ |
| InChIKey | RWVKACDSWPNIQR-BNOFJFBZSA-N |
| XLogP | 5.81 |
| TPSA | 80.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.86 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|