C30H42N2O3S — CID 146512873
3-(15-tert-butyl-16-hydroxy-9,12-dimethyl-8-oxo-6-tricyclo[11.4.0.05,9]heptadeca-1(17),13,15-trienyl)-N-(5-methyl-1,3-thiazol-2-yl)propanamide (PubChem CID 146512873) has the molecular formula C30H42N2O3S and a molecular weight of 510.74 g/mol. Its IUPAC name is 3-(15-tert-butyl-16-hydroxy-9,12-dimethyl-8-oxo-6-tricyclo[11.4.0.05,9]heptadeca-1(17),13,15-trienyl)-N-(5-methyl-1,3-thiazol-2-yl)propanamide.
| Compound Name | 3-(15-tert-butyl-16-hydroxy-9,12-dimethyl-8-oxo-6-tricyclo[11.4.0.05,9]heptadeca-1(17),13,15-trienyl)-N-(5-methyl-1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 146512873 |
| Molecular Formula | C30H42N2O3S |
| Molecular Weight | 510.74 g/mol |
| Exact Mass | 510.29 |
| IUPAC Name | 3-(15-tert-butyl-16-hydroxy-9,12-dimethyl-8-oxo-6-tricyclo[11.4.0.05,9]heptadeca-1(17),13,15-trienyl)-N-(5-methyl-1,3-thiazol-2-yl)propanamide |
| SMILES | Cc1cnc(NC(=O)CCC2CC(=O)C3(C)CCC(C)c4cc(C(C)(C)C)c(O)cc4CCCC23)s1 |
| InChI | InChI=1S/C30H42N2O3S/c1-18-12-13-30(6)23(9-7-8-20-14-25(33)24(16-22(18)20)29(3,4)5)21(15-26(30)34)10-11-27(35)32-28-31-17-19(2)36-28/h14,16-18,21,23,33H,7-13,15H2,1-6H3,(H,31,32,35) |
| InChIKey | YIHKGFLJGFGXAR-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.74 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |