C8H8N2O6 — CID 14651676
2,4,6-trihydroxy-N-methyl-3-nitrobenzamide (PubChem CID 14651676) has the molecular formula C8H8N2O6 and a molecular weight of 228.16 g/mol. Its IUPAC name is 2,4,6-trihydroxy-N-methyl-3-nitrobenzamide.
| Compound Name | 2,4,6-trihydroxy-N-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 14651676 |
| Molecular Formula | C8H8N2O6 |
| Molecular Weight | 228.16 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | 2,4,6-trihydroxy-N-methyl-3-nitrobenzamide |
| SMILES | CNC(=O)c1c(O)cc(O)c([N+](=O)[O-])c1O |
| InChI | InChI=1S/C8H8N2O6/c1-9-8(14)5-3(11)2-4(12)6(7(5)13)10(15)16/h2,11-13H,1H3,(H,9,14) |
| InChIKey | AUWJIXZLNBYPCU-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 132.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.16 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|