C13H10N2O7 — CID 71592623
2,4,6-trihydroxy-N-(4-hydroxyphenyl)-3-nitrobenzamide (PubChem CID 71592623) has the molecular formula C13H10N2O7 and a molecular weight of 306.23 g/mol. Its IUPAC name is 2,4,6-trihydroxy-N-(4-hydroxyphenyl)-3-nitrobenzamide.
| Compound Name | 2,4,6-trihydroxy-N-(4-hydroxyphenyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 71592623 |
| Molecular Formula | C13H10N2O7 |
| Molecular Weight | 306.23 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | 2,4,6-trihydroxy-N-(4-hydroxyphenyl)-3-nitrobenzamide |
| SMILES | O=C(Nc1ccc(O)cc1)c1c(O)cc(O)c([N+](=O)[O-])c1O |
| InChI | InChI=1S/C13H10N2O7/c16-7-3-1-6(2-4-7)14-13(20)10-8(17)5-9(18)11(12(10)19)15(21)22/h1-5,16-19H,(H,14,20) |
| InChIKey | GRNYNRFRNIRUDL-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 153.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.23 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|