C67H51N5 — CID 146521279
3-(4b-methyl-8aH-carbazol-9-yl)-9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,6-diphenylphenyl]-6-(2,4,6-trimethylphenyl)carbazole (PubChem CID 146521279) has the molecular formula C67H51N5 and a molecular weight of 926.18 g/mol. Its IUPAC name is 3-(4b-methyl-8aH-carbazol-9-yl)-9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,6-diphenylphenyl]-6-(2,4,6-trimethylphenyl)carbazole.
| Compound Name | 3-(4b-methyl-8aH-carbazol-9-yl)-9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,6-diphenylphenyl]-6-(2,4,6-trimethylphenyl)carbazole |
|---|---|
| PubChem CID | 146521279 |
| Molecular Formula | C67H51N5 |
| Molecular Weight | 926.18 g/mol |
| Exact Mass | 925.41 |
| IUPAC Name | 3-(4b-methyl-8aH-carbazol-9-yl)-9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,6-diphenylphenyl]-6-(2,4,6-trimethylphenyl)carbazole |
| SMILES | Cc1cc(C)c(-c2ccc3c(c2)c2cc(N4c5ccccc5C5(C)C=CC=CC45)ccc2n3-c2c(-c3ccccc3)cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc2-c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C67H51N5/c1-43-37-44(2)62(45(3)38-43)50-32-34-58-55(39-50)56-42-52(71-60-30-18-17-29-57(60)67(4)36-20-19-31-61(67)71)33-35-59(56)72(58)63-53(46-21-9-5-10-22-46)40-51(41-54(63)47-23-11-6-12-24-47)66-69-64(48-25-13-7-14-26-48)68-65(70-66)49-27-15-8-16-28-49/h5-42,61H,1-4H3 |
| InChIKey | OZRGABOFUIKZSQ-UHFFFAOYSA-N |
| XLogP | 16.80 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 926.18 |
| LogP ≤ 5 | 16.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |