About 5-ethenyl-6-methyl-7,8-dihydroisoquinoline
5-ethenyl-6-methyl-7,8-dihydroisoquinoline (PubChem CID 146521730) has the molecular formula C12H13N
and a molecular weight of 171.24 g/mol. Its IUPAC name is 5-ethenyl-6-methyl-7,8-dihydroisoquinoline.
Molecular Properties
| Compound Name | 5-ethenyl-6-methyl-7,8-dihydroisoquinoline |
| PubChem CID | 146521730 |
| Molecular Formula | C12H13N |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | 5-ethenyl-6-methyl-7,8-dihydroisoquinoline |
| SMILES | C=CC1=C(C)CCc2cnccc21 |
| InChI | InChI=1S/C12H13N/c1-3-11-9(2)4-5-10-8-13-7-6-12(10)11/h3,6-8H,1,4-5H2,2H3 |
| InChIKey | AIMVMRUZUMTNTC-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-ethenyl-6-methyl-7,8-dihydroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethenyl-6-methyl-7,8-dihydroisoquinoline?
The IUPAC name of 5-ethenyl-6-methyl-7,8-dihydroisoquinoline (CID 146521730) is 5-ethenyl-6-methyl-7,8-dihydroisoquinoline.
What is the SMILES notation for 5-ethenyl-6-methyl-7,8-dihydroisoquinoline?
The canonical SMILES for 5-ethenyl-6-methyl-7,8-dihydroisoquinoline is C=CC1=C(C)CCc2cnccc21.
What is the InChIKey of 5-ethenyl-6-methyl-7,8-dihydroisoquinoline?
The InChIKey is AIMVMRUZUMTNTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N/c1-3-11-9(2)4-5-10-8-13-7-6-12(10)11/h3,6-8H,1,4-5H2,2H3.
What are the key properties of 5-ethenyl-6-methyl-7,8-dihydroisoquinoline?
5-ethenyl-6-methyl-7,8-dihydroisoquinoline has a molecular weight of 171.24 g/mol, XLogP of 2.99, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethenyl-6-methyl-7,8-dihydroisoquinoline is sourced from PubChem (CID 146521730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).