C22H28F4N8O3 — CID 146527150
(Z)-2-amino-3-[amino-[2-fluoro-4-[6-[[2-[4-(1,1,1-trifluoropropan-2-yloxy)-2-pyridinyl]acetyl]amino]pyridazin-3-yl]butyl]amino]-N-methylprop-2-enamide (PubChem CID 146527150) has the molecular formula C22H28F4N8O3 and a molecular weight of 528.51 g/mol. Its IUPAC name is (Z)-2-amino-3-[amino-[2-fluoro-4-[6-[[2-[4-(1,1,1-trifluoropropan-2-yloxy)-2-pyridinyl]acetyl]amino]pyridazin-3-yl]butyl]amino]-N-methylprop-2-enamide.
| Compound Name | (Z)-2-amino-3-[amino-[2-fluoro-4-[6-[[2-[4-(1,1,1-trifluoropropan-2-yloxy)-2-pyridinyl]acetyl]amino]pyridazin-3-yl]butyl]amino]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 146527150 |
| Molecular Formula | C22H28F4N8O3 |
| Molecular Weight | 528.51 g/mol |
| Exact Mass | 528.22 |
| IUPAC Name | (Z)-2-amino-3-[amino-[2-fluoro-4-[6-[[2-[4-(1,1,1-trifluoropropan-2-yloxy)-2-pyridinyl]acetyl]amino]pyridazin-3-yl]butyl]amino]-N-methylprop-2-enamide |
| SMILES | CNC(=O)/C(N)=C/N(N)CC(F)CCc1ccc(NC(=O)Cc2cc(OC(C)C(F)(F)F)ccn2)nn1 |
| InChI | InChI=1S/C22H28F4N8O3/c1-13(22(24,25)26)37-17-7-8-30-16(9-17)10-20(35)31-19-6-5-15(32-33-19)4-3-14(23)11-34(28)12-18(27)21(36)29-2/h5-9,12-14H,3-4,10-11,27-28H2,1-2H3,(H,29,36)(H,31,33,35)/b18-12- |
| InChIKey | WLCGTXAPAFYKLU-PDGQHHTCSA-N |
| XLogP | 1.37 |
| TPSA | 161.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.51 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|