C12H8F3IN4O — CID 164854074
N-(6-iodopyridazin-3-yl)-2-[4-(trifluoromethyl)-2-pyridinyl]acetamide (PubChem CID 164854074) has the molecular formula C12H8F3IN4O and a molecular weight of 408.12 g/mol. Its IUPAC name is N-(6-iodopyridazin-3-yl)-2-[4-(trifluoromethyl)-2-pyridinyl]acetamide.
| Compound Name | N-(6-iodopyridazin-3-yl)-2-[4-(trifluoromethyl)-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 164854074 |
| Molecular Formula | C12H8F3IN4O |
| Molecular Weight | 408.12 g/mol |
| Exact Mass | 407.97 |
| IUPAC Name | N-(6-iodopyridazin-3-yl)-2-[4-(trifluoromethyl)-2-pyridinyl]acetamide |
| SMILES | O=C(Cc1cc(C(F)(F)F)ccn1)Nc1ccc(I)nn1 |
| InChI | InChI=1S/C12H8F3IN4O/c13-12(14,15)7-3-4-17-8(5-7)6-11(21)18-10-2-1-9(16)19-20-10/h1-5H,6H2,(H,18,20,21) |
| InChIKey | PHLGHDYXNRACGI-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.12 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|