C13H20FN7O2 — CID 146527284
(Z)-2-amino-3-[amino-[2-fluoro-4-(6-formamidopyridazin-3-yl)butyl]amino]-N-methylprop-2-enamide (PubChem CID 146527284) has the molecular formula C13H20FN7O2 and a molecular weight of 325.35 g/mol. Its IUPAC name is (Z)-2-amino-3-[amino-[2-fluoro-4-(6-formamidopyridazin-3-yl)butyl]amino]-N-methylprop-2-enamide.
| Compound Name | (Z)-2-amino-3-[amino-[2-fluoro-4-(6-formamidopyridazin-3-yl)butyl]amino]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 146527284 |
| Molecular Formula | C13H20FN7O2 |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | (Z)-2-amino-3-[amino-[2-fluoro-4-(6-formamidopyridazin-3-yl)butyl]amino]-N-methylprop-2-enamide |
| SMILES | CNC(=O)/C(N)=C/N(N)CC(F)CCc1ccc(NC=O)nn1 |
| InChI | InChI=1S/C13H20FN7O2/c1-17-13(23)11(15)7-21(16)6-9(14)2-3-10-4-5-12(18-8-22)20-19-10/h4-5,7-9H,2-3,6,15-16H2,1H3,(H,17,23)(H,18,20,22)/b11-7- |
| InChIKey | YHEWNUUIMUZFHB-XFFZJAGNSA-N |
| XLogP | -0.96 |
| TPSA | 139.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|