C19H26N4O5S — CID 146530118
N-(2-methoxyethyl)-5-[(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)sulfonyl]-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrole-2-carboxamide (PubChem CID 146530118) has the molecular formula C19H26N4O5S and a molecular weight of 422.51 g/mol. Its IUPAC name is N-(2-methoxyethyl)-5-[(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)sulfonyl]-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrole-2-carboxamide.
| Compound Name | N-(2-methoxyethyl)-5-[(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)sulfonyl]-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 146530118 |
| Molecular Formula | C19H26N4O5S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | N-(2-methoxyethyl)-5-[(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)sulfonyl]-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrole-2-carboxamide |
| SMILES | COCCNC(=O)N1CC2=C(C1)CN(S(=O)(=O)c1ccc3c(c1)N(C)CCO3)C2 |
| InChI | InChI=1S/C19H26N4O5S/c1-21-6-8-28-18-4-3-16(9-17(18)21)29(25,26)23-12-14-10-22(11-15(14)13-23)19(24)20-5-7-27-2/h3-4,9H,5-8,10-13H2,1-2H3,(H,20,24) |
| InChIKey | JDPASOQXHMLPGR-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|