C29H31NO2 — CID 146533179
1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-3-methyl-4-[6-(4-prop-1-en-2-ylphenyl)-2-bicyclo[2.2.1]hept-2-enyl]pyrrole-2,5-dione (PubChem CID 146533179) has the molecular formula C29H31NO2 and a molecular weight of 425.57 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-3-methyl-4-[6-(4-prop-1-en-2-ylphenyl)-2-bicyclo[2.2.1]hept-2-enyl]pyrrole-2,5-dione.
| Compound Name | 1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-3-methyl-4-[6-(4-prop-1-en-2-ylphenyl)-2-bicyclo[2.2.1]hept-2-enyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 146533179 |
| Molecular Formula | C29H31NO2 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-3-methyl-4-[6-(4-prop-1-en-2-ylphenyl)-2-bicyclo[2.2.1]hept-2-enyl]pyrrole-2,5-dione |
| SMILES | C=C(C)c1ccc(C2CC3C=C(C4=C(C)C(=O)N(CC5CC6C=CC5C6)C4=O)C2C3)cc1 |
| InChI | InChI=1S/C29H31NO2/c1-16(2)20-6-8-21(9-7-20)24-12-19-13-25(24)26(14-19)27-17(3)28(31)30(29(27)32)15-23-11-18-4-5-22(23)10-18/h4-9,14,18-19,22-25H,1,10-13,15H2,2-3H3 |
| InChIKey | GGLGLVCAUJHEJN-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|