C16H33NO3 — CID 146534659
6-amino-2-methyl-2-[3-methyl-3-[(2-methylpropan-2-yl)oxy]butoxy]hexan-3-one (PubChem CID 146534659) has the molecular formula C16H33NO3 and a molecular weight of 287.44 g/mol. Its IUPAC name is 6-amino-2-methyl-2-[3-methyl-3-[(2-methylpropan-2-yl)oxy]butoxy]hexan-3-one.
| Compound Name | 6-amino-2-methyl-2-[3-methyl-3-[(2-methylpropan-2-yl)oxy]butoxy]hexan-3-one |
|---|---|
| PubChem CID | 146534659 |
| Molecular Formula | C16H33NO3 |
| Molecular Weight | 287.44 g/mol |
| Exact Mass | 287.25 |
| IUPAC Name | 6-amino-2-methyl-2-[3-methyl-3-[(2-methylpropan-2-yl)oxy]butoxy]hexan-3-one |
| SMILES | CC(C)(C)OC(C)(C)CCOC(C)(C)C(=O)CCCN |
| InChI | InChI=1S/C16H33NO3/c1-14(2,3)20-15(4,5)10-12-19-16(6,7)13(18)9-8-11-17/h8-12,17H2,1-7H3 |
| InChIKey | USRYBKCBHFVXEU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.44 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |