C12H11ClN4O5 — CID 146540493
5-chloro-4-[(4,6-dioxo-1H-1,3,5-triazin-2-yl)amino]-2-ethoxybenzoic acid (PubChem CID 146540493) has the molecular formula C12H11ClN4O5 and a molecular weight of 326.70 g/mol. Its IUPAC name is 5-chloro-4-[(4,6-dioxo-1H-1,3,5-triazin-2-yl)amino]-2-ethoxybenzoic acid.
| Compound Name | 5-chloro-4-[(4,6-dioxo-1H-1,3,5-triazin-2-yl)amino]-2-ethoxybenzoic acid |
|---|---|
| PubChem CID | 146540493 |
| Molecular Formula | C12H11ClN4O5 |
| Molecular Weight | 326.70 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 5-chloro-4-[(4,6-dioxo-1H-1,3,5-triazin-2-yl)amino]-2-ethoxybenzoic acid |
| SMILES | CCOc1cc(Nc2nc(=O)[nH]c(=O)[nH]2)c(Cl)cc1C(=O)O |
| InChI | InChI=1S/C12H11ClN4O5/c1-2-22-8-4-7(6(13)3-5(8)9(18)19)14-10-15-11(20)17-12(21)16-10/h3-4H,2H2,1H3,(H,18,19)(H3,14,15,16,17,20,21) |
| InChIKey | JRJDAURIUHWHCF-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 137.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.70 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |