C11H9ClN2O3S — CID 43614491
5-chloro-2-methoxy-4-(1,3-thiazol-2-ylamino)benzoic acid (PubChem CID 43614491) has the molecular formula C11H9ClN2O3S and a molecular weight of 284.72 g/mol. Its IUPAC name is 5-chloro-2-methoxy-4-(1,3-thiazol-2-ylamino)benzoic acid.
| Compound Name | 5-chloro-2-methoxy-4-(1,3-thiazol-2-ylamino)benzoic acid |
|---|---|
| PubChem CID | 43614491 |
| Molecular Formula | C11H9ClN2O3S |
| Molecular Weight | 284.72 g/mol |
| Exact Mass | 284.00 |
| IUPAC Name | 5-chloro-2-methoxy-4-(1,3-thiazol-2-ylamino)benzoic acid |
| SMILES | COc1cc(Nc2nccs2)c(Cl)cc1C(=O)O |
| InChI | InChI=1S/C11H9ClN2O3S/c1-17-9-5-8(14-11-13-2-3-18-11)7(12)4-6(9)10(15)16/h2-5H,1H3,(H,13,14)(H,15,16) |
| InChIKey | SNEFFWYUUWJDGN-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.72 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |