C11H20O4 — CID 146545133
(2S,3S)-2-(2-methoxyethoxymethyl)-3-methylhex-5-enoic acid (PubChem CID 146545133) has the molecular formula C11H20O4 and a molecular weight of 216.28 g/mol. Its IUPAC name is (2S,3S)-2-(2-methoxyethoxymethyl)-3-methylhex-5-enoic acid.
| Compound Name | (2S,3S)-2-(2-methoxyethoxymethyl)-3-methylhex-5-enoic acid |
|---|---|
| PubChem CID | 146545133 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | (2S,3S)-2-(2-methoxyethoxymethyl)-3-methylhex-5-enoic acid |
| SMILES | C=CC[C@H](C)[C@@H](COCCOC)C(=O)O |
| InChI | InChI=1S/C11H20O4/c1-4-5-9(2)10(11(12)13)8-15-7-6-14-3/h4,9-10H,1,5-8H2,2-3H3,(H,12,13)/t9-,10+/m0/s1 |
| InChIKey | UEIXSMWEQJBHJF-VHSXEESVSA-N |
| XLogP | 1.56 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|