C29H58O13 — CID 89453262
1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-2,2-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxymethyl]hex-5-en-3-ol (PubChem CID 89453262) has the molecular formula C29H58O13 and a molecular weight of 614.77 g/mol. Its IUPAC name is 1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-2,2-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxymethyl]hex-5-en-3-ol.
| Compound Name | 1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-2,2-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxymethyl]hex-5-en-3-ol |
|---|---|
| PubChem CID | 89453262 |
| Molecular Formula | C29H58O13 |
| Molecular Weight | 614.77 g/mol |
| Exact Mass | 614.39 |
| IUPAC Name | 1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-2,2-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxymethyl]hex-5-en-3-ol |
| SMILES | C=CCC(O)C(COCCOCCOCCOC)(COCCOCCOCCOC)COCCOCCOCCOC |
| InChI | InChI=1S/C29H58O13/c1-5-6-28(30)29(25-40-22-19-37-16-13-34-10-7-31-2,26-41-23-20-38-17-14-35-11-8-32-3)27-42-24-21-39-18-15-36-12-9-33-4/h5,28,30H,1,6-27H2,2-4H3 |
| InChIKey | MIHAVRUHDAISQG-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 130.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.77 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|