C13H27NO4 — CID 146550735
(2R,3R,4Z)-5-methoxy-6-methyl-4-(2-methylpropoxyimino)heptane-2,3-diol (PubChem CID 146550735) has the molecular formula C13H27NO4 and a molecular weight of 261.36 g/mol. Its IUPAC name is (2R,3R,4Z)-5-methoxy-6-methyl-4-(2-methylpropoxyimino)heptane-2,3-diol.
| Compound Name | (2R,3R,4Z)-5-methoxy-6-methyl-4-(2-methylpropoxyimino)heptane-2,3-diol |
|---|---|
| PubChem CID | 146550735 |
| Molecular Formula | C13H27NO4 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.19 |
| IUPAC Name | (2R,3R,4Z)-5-methoxy-6-methyl-4-(2-methylpropoxyimino)heptane-2,3-diol |
| SMILES | COC(/C(=N\OCC(C)C)[C@@H](O)[C@@H](C)O)C(C)C |
| InChI | InChI=1S/C13H27NO4/c1-8(2)7-18-14-11(12(16)10(5)15)13(17-6)9(3)4/h8-10,12-13,15-16H,7H2,1-6H3/b14-11-/t10-,12+,13?/m1/s1 |
| InChIKey | SUICXZQLWYDKMO-RVRHBWQCSA-N |
| XLogP | 1.43 |
| TPSA | 71.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|