C13H27NO4 — CID 146550772
(4Z,5S)-5-methoxy-6-methyl-4-[(2-methylpropan-2-yl)oxyimino]heptane-2,3-diol (PubChem CID 146550772) has the molecular formula C13H27NO4 and a molecular weight of 261.36 g/mol. Its IUPAC name is (4Z,5S)-5-methoxy-6-methyl-4-[(2-methylpropan-2-yl)oxyimino]heptane-2,3-diol.
| Compound Name | (4Z,5S)-5-methoxy-6-methyl-4-[(2-methylpropan-2-yl)oxyimino]heptane-2,3-diol |
|---|---|
| PubChem CID | 146550772 |
| Molecular Formula | C13H27NO4 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.19 |
| IUPAC Name | (4Z,5S)-5-methoxy-6-methyl-4-[(2-methylpropan-2-yl)oxyimino]heptane-2,3-diol |
| SMILES | CO[C@H](/C(=N\OC(C)(C)C)C(O)C(C)O)C(C)C |
| InChI | InChI=1S/C13H27NO4/c1-8(2)12(17-7)10(11(16)9(3)15)14-18-13(4,5)6/h8-9,11-12,15-16H,1-7H3/b14-10-/t9?,11?,12-/m0/s1 |
| InChIKey | YGNJZSXZPKTMRK-IWDLUNDOSA-N |
| XLogP | 1.57 |
| TPSA | 71.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|