C6H6ClN3O — CID 146553707
6-chloro-5-methoxy-1,6-dihydropyridazine-3-carbonitrile (PubChem CID 146553707) has the molecular formula C6H6ClN3O and a molecular weight of 171.59 g/mol. Its IUPAC name is 6-chloro-5-methoxy-1,6-dihydropyridazine-3-carbonitrile.
| Compound Name | 6-chloro-5-methoxy-1,6-dihydropyridazine-3-carbonitrile |
|---|---|
| PubChem CID | 146553707 |
| Molecular Formula | C6H6ClN3O |
| Molecular Weight | 171.59 g/mol |
| Exact Mass | 171.02 |
| IUPAC Name | 6-chloro-5-methoxy-1,6-dihydropyridazine-3-carbonitrile |
| SMILES | COC1=CC(C#N)=NNC1Cl |
| InChI | InChI=1S/C6H6ClN3O/c1-11-5-2-4(3-8)9-10-6(5)7/h2,6,10H,1H3 |
| InChIKey | HWQWEVQSOSBSIS-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 57.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.59 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|