C25H36N2O4 — CID 146554960
[(2R)-2-[4-[4-[hydroxy(methoxy)methyl]piperidin-2-yl]phenyl]-6-azaspiro[2.5]octan-6-yl]-[(2R)-oxolan-2-yl]methanone (PubChem CID 146554960) has the molecular formula C25H36N2O4 and a molecular weight of 428.57 g/mol. Its IUPAC name is [(2R)-2-[4-[4-[hydroxy(methoxy)methyl]piperidin-2-yl]phenyl]-6-azaspiro[2.5]octan-6-yl]-[(2R)-oxolan-2-yl]methanone.
| Compound Name | [(2R)-2-[4-[4-[hydroxy(methoxy)methyl]piperidin-2-yl]phenyl]-6-azaspiro[2.5]octan-6-yl]-[(2R)-oxolan-2-yl]methanone |
|---|---|
| PubChem CID | 146554960 |
| Molecular Formula | C25H36N2O4 |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.27 |
| IUPAC Name | [(2R)-2-[4-[4-[hydroxy(methoxy)methyl]piperidin-2-yl]phenyl]-6-azaspiro[2.5]octan-6-yl]-[(2R)-oxolan-2-yl]methanone |
| SMILES | COC(O)C1CCNC(c2ccc([C@@H]3CC34CCN(C(=O)[C@H]3CCCO3)CC4)cc2)C1 |
| InChI | InChI=1S/C25H36N2O4/c1-30-24(29)19-8-11-26-21(15-19)18-6-4-17(5-7-18)20-16-25(20)9-12-27(13-10-25)23(28)22-3-2-14-31-22/h4-7,19-22,24,26,29H,2-3,8-16H2,1H3/t19?,20-,21?,22+,24?/m0/s1 |
| InChIKey | FOXHJWBOECCSMY-AYQXISFZSA-N |
| XLogP | 2.97 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|