C25H18F3N3O — CID 146563683
3-methyl-2-(2-phthalazin-6-ylethynyl)-6-[[3-(trifluoromethyl)anilino]methyl]phenol (PubChem CID 146563683) has the molecular formula C25H18F3N3O and a molecular weight of 433.43 g/mol. Its IUPAC name is 3-methyl-2-(2-phthalazin-6-ylethynyl)-6-[[3-(trifluoromethyl)anilino]methyl]phenol.
| Compound Name | 3-methyl-2-(2-phthalazin-6-ylethynyl)-6-[[3-(trifluoromethyl)anilino]methyl]phenol |
|---|---|
| PubChem CID | 146563683 |
| Molecular Formula | C25H18F3N3O |
| Molecular Weight | 433.43 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | 3-methyl-2-(2-phthalazin-6-ylethynyl)-6-[[3-(trifluoromethyl)anilino]methyl]phenol |
| SMILES | Cc1ccc(CNc2cccc(C(F)(F)F)c2)c(O)c1C#Cc1ccc2cnncc2c1 |
| InChI | InChI=1S/C25H18F3N3O/c1-16-5-8-19(13-29-22-4-2-3-21(12-22)25(26,27)28)24(32)23(16)10-7-17-6-9-18-14-30-31-15-20(18)11-17/h2-6,8-9,11-12,14-15,29,32H,13H2,1H3 |
| InChIKey | RDHFKESIRYMVKH-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.43 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|