C13H8F3N3 — CID 16736016
5-methyl-3-[2-[3-(trifluoromethyl)phenyl]ethynyl]-1,2,4-triazine (PubChem CID 16736016) has the molecular formula C13H8F3N3 and a molecular weight of 263.22 g/mol. Its IUPAC name is 5-methyl-3-[2-[3-(trifluoromethyl)phenyl]ethynyl]-1,2,4-triazine.
| Compound Name | 5-methyl-3-[2-[3-(trifluoromethyl)phenyl]ethynyl]-1,2,4-triazine |
|---|---|
| PubChem CID | 16736016 |
| Molecular Formula | C13H8F3N3 |
| Molecular Weight | 263.22 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 5-methyl-3-[2-[3-(trifluoromethyl)phenyl]ethynyl]-1,2,4-triazine |
| SMILES | Cc1cnnc(C#Cc2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C13H8F3N3/c1-9-8-17-19-12(18-9)6-5-10-3-2-4-11(7-10)13(14,15)16/h2-4,7-8H,1H3 |
| InChIKey | GSSJQBLTGAEIQZ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.22 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|