C23H18F3NO2 — CID 91604742
2-[3-[2-[3-(trifluoromethyl)phenyl]ethynyl]phenyl]-4,5,6,7-tetrahydroisoindole-1,3-diol (PubChem CID 91604742) has the molecular formula C23H18F3NO2 and a molecular weight of 397.40 g/mol. Its IUPAC name is 2-[3-[2-[3-(trifluoromethyl)phenyl]ethynyl]phenyl]-4,5,6,7-tetrahydroisoindole-1,3-diol.
| Compound Name | 2-[3-[2-[3-(trifluoromethyl)phenyl]ethynyl]phenyl]-4,5,6,7-tetrahydroisoindole-1,3-diol |
|---|---|
| PubChem CID | 91604742 |
| Molecular Formula | C23H18F3NO2 |
| Molecular Weight | 397.40 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | 2-[3-[2-[3-(trifluoromethyl)phenyl]ethynyl]phenyl]-4,5,6,7-tetrahydroisoindole-1,3-diol |
| SMILES | Oc1c2c(c(O)n1-c1cccc(C#Cc3cccc(C(F)(F)F)c3)c1)CCCC2 |
| InChI | InChI=1S/C23H18F3NO2/c24-23(25,26)17-7-3-5-15(13-17)11-12-16-6-4-8-18(14-16)27-21(28)19-9-1-2-10-20(19)22(27)29/h3-8,13-14,28-29H,1-2,9-10H2 |
| InChIKey | WSAGVDLUFIVPHV-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.40 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|