About 1-O-ethyl 3-O-[3-[5-(hydroxymethyl)furan-2-yl]-3-oxopropyl] propanedioate
1-O-ethyl 3-O-[3-[5-(hydroxymethyl)furan-2-yl]-3-oxopropyl] propanedioate (PubChem CID 146563740) has the molecular formula C13H16O7
and a molecular weight of 284.26 g/mol. Its IUPAC name is 1-O-ethyl 3-O-[3-[5-(hydroxymethyl)furan-2-yl]-3-oxopropyl] propanedioate.
Molecular Properties
| Compound Name | 1-O-ethyl 3-O-[3-[5-(hydroxymethyl)furan-2-yl]-3-oxopropyl] propanedioate |
| PubChem CID | 146563740 |
| Molecular Formula | C13H16O7 |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 1-O-ethyl 3-O-[3-[5-(hydroxymethyl)furan-2-yl]-3-oxopropyl] propanedioate |
| SMILES | CCOC(=O)CC(=O)OCCC(=O)c1ccc(CO)o1 |
| InChI | InChI=1S/C13H16O7/c1-2-18-12(16)7-13(17)19-6-5-10(15)11-4-3-9(8-14)20-11/h3-4,14H,2,5-8H2,1H3 |
| InChIKey | GTTVELXFZAANOH-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.26 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-O-ethyl 3-O-[3-[5-(hydroxymethyl)furan-2-yl]-3-oxopropyl] propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-ethyl 3-O-[3-[5-(hydroxymethyl)furan-2-yl]-3-oxopropyl] propanedioate?
The IUPAC name of 1-O-ethyl 3-O-[3-[5-(hydroxymethyl)furan-2-yl]-3-oxopropyl] propanedioate (CID 146563740) is 1-O-ethyl 3-O-[3-[5-(hydroxymethyl)furan-2-yl]-3-oxopropyl] propanedioate.
What is the SMILES notation for 1-O-ethyl 3-O-[3-[5-(hydroxymethyl)furan-2-yl]-3-oxopropyl] propanedioate?
The canonical SMILES for 1-O-ethyl 3-O-[3-[5-(hydroxymethyl)furan-2-yl]-3-oxopropyl] propanedioate is CCOC(=O)CC(=O)OCCC(=O)c1ccc(CO)o1.
What is the InChIKey of 1-O-ethyl 3-O-[3-[5-(hydroxymethyl)furan-2-yl]-3-oxopropyl] propanedioate?
The InChIKey is GTTVELXFZAANOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O7/c1-2-18-12(16)7-13(17)19-6-5-10(15)11-4-3-9(8-14)20-11/h3-4,14H,2,5-8H2,1H3.
What are the key properties of 1-O-ethyl 3-O-[3-[5-(hydroxymethyl)furan-2-yl]-3-oxopropyl] propanedioate?
1-O-ethyl 3-O-[3-[5-(hydroxymethyl)furan-2-yl]-3-oxopropyl] propanedioate has a molecular weight of 284.26 g/mol, XLogP of 0.84, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-ethyl 3-O-[3-[5-(hydroxymethyl)furan-2-yl]-3-oxopropyl] propanedioate is sourced from PubChem (CID 146563740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).