C11H12O4 — CID 67891886
1-[5-(hydroxymethyl)furan-2-yl]ethenyl 2-methylprop-2-enoate (PubChem CID 67891886) has the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. Its IUPAC name is 1-[5-(hydroxymethyl)furan-2-yl]ethenyl 2-methylprop-2-enoate.
| Compound Name | 1-[5-(hydroxymethyl)furan-2-yl]ethenyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 67891886 |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 1-[5-(hydroxymethyl)furan-2-yl]ethenyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(=C)c1ccc(CO)o1 |
| InChI | InChI=1S/C11H12O4/c1-7(2)11(13)14-8(3)10-5-4-9(6-12)15-10/h4-5,12H,1,3,6H2,2H3 |
| InChIKey | WOYXWPGCPXOSMC-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|