C38H29N5O4 — CID 146567334
3-[8-(2,4-dioxo-1H-pyrido[3,4-d]pyrimidin-3-yl)quinolin-5-yl]-2-(tritylamino)propanoic acid (PubChem CID 146567334) has the molecular formula C38H29N5O4 and a molecular weight of 619.68 g/mol. Its IUPAC name is 3-[8-(2,4-dioxo-1H-pyrido[3,4-d]pyrimidin-3-yl)quinolin-5-yl]-2-(tritylamino)propanoic acid.
| Compound Name | 3-[8-(2,4-dioxo-1H-pyrido[3,4-d]pyrimidin-3-yl)quinolin-5-yl]-2-(tritylamino)propanoic acid |
|---|---|
| PubChem CID | 146567334 |
| Molecular Formula | C38H29N5O4 |
| Molecular Weight | 619.68 g/mol |
| Exact Mass | 619.22 |
| IUPAC Name | 3-[8-(2,4-dioxo-1H-pyrido[3,4-d]pyrimidin-3-yl)quinolin-5-yl]-2-(tritylamino)propanoic acid |
| SMILES | O=C(O)C(Cc1ccc(-n2c(=O)[nH]c3cnccc3c2=O)c2ncccc12)NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H29N5O4/c44-35-30-20-22-39-24-32(30)41-37(47)43(35)33-19-18-25(29-17-10-21-40-34(29)33)23-31(36(45)46)42-38(26-11-4-1-5-12-26,27-13-6-2-7-14-27)28-15-8-3-9-16-28/h1-22,24,31,42H,23H2,(H,41,47)(H,45,46) |
| InChIKey | RLORCFOCCMARCW-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 129.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.68 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|