C13H14ClN5O — CID 146568088
3-chloro-N-(2-methoxyethyl)-5-(1H-pyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridin-4-amine (PubChem CID 146568088) has the molecular formula C13H14ClN5O and a molecular weight of 291.74 g/mol. Its IUPAC name is 3-chloro-N-(2-methoxyethyl)-5-(1H-pyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridin-4-amine.
| Compound Name | 3-chloro-N-(2-methoxyethyl)-5-(1H-pyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridin-4-amine |
|---|---|
| PubChem CID | 146568088 |
| Molecular Formula | C13H14ClN5O |
| Molecular Weight | 291.74 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 3-chloro-N-(2-methoxyethyl)-5-(1H-pyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridin-4-amine |
| SMILES | COCCNc1c(-c2cn[nH]c2)cnc2[nH]cc(Cl)c12 |
| InChI | InChI=1S/C13H14ClN5O/c1-20-3-2-15-12-9(8-4-18-19-5-8)6-16-13-11(12)10(14)7-17-13/h4-7H,2-3H2,1H3,(H,18,19)(H2,15,16,17) |
| InChIKey | NRUOWSTYDZDCTJ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.74 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|