C14H17N7OS — CID 66668784
5-N-(2-methoxyethyl)-2-N-methyl-4-(1H-pyrazol-4-yl)-2-N-pyrimidin-2-yl-1,3-thiazole-2,5-diamine (PubChem CID 66668784) has the molecular formula C14H17N7OS and a molecular weight of 331.41 g/mol. Its IUPAC name is 5-N-(2-methoxyethyl)-2-N-methyl-4-(1H-pyrazol-4-yl)-2-N-pyrimidin-2-yl-1,3-thiazole-2,5-diamine.
| Compound Name | 5-N-(2-methoxyethyl)-2-N-methyl-4-(1H-pyrazol-4-yl)-2-N-pyrimidin-2-yl-1,3-thiazole-2,5-diamine |
|---|---|
| PubChem CID | 66668784 |
| Molecular Formula | C14H17N7OS |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 5-N-(2-methoxyethyl)-2-N-methyl-4-(1H-pyrazol-4-yl)-2-N-pyrimidin-2-yl-1,3-thiazole-2,5-diamine |
| SMILES | COCCNc1sc(N(C)c2ncccn2)nc1-c1cn[nH]c1 |
| InChI | InChI=1S/C14H17N7OS/c1-21(13-16-4-3-5-17-13)14-20-11(10-8-18-19-9-10)12(23-14)15-6-7-22-2/h3-5,8-9,15H,6-7H2,1-2H3,(H,18,19) |
| InChIKey | ZDDVQQCOAFJAPW-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|