C30H63N — CID 146572754
6-ethyl-2,4,4,7,7,9-hexamethyl-N-propan-2-yl-5-(2,4,4-trimethylpentan-2-yl)undecan-2-amine (PubChem CID 146572754) has the molecular formula C30H63N and a molecular weight of 437.84 g/mol. Its IUPAC name is 6-ethyl-2,4,4,7,7,9-hexamethyl-N-propan-2-yl-5-(2,4,4-trimethylpentan-2-yl)undecan-2-amine.
| Compound Name | 6-ethyl-2,4,4,7,7,9-hexamethyl-N-propan-2-yl-5-(2,4,4-trimethylpentan-2-yl)undecan-2-amine |
|---|---|
| PubChem CID | 146572754 |
| Molecular Formula | C30H63N |
| Molecular Weight | 437.84 g/mol |
| Exact Mass | 437.50 |
| IUPAC Name | 6-ethyl-2,4,4,7,7,9-hexamethyl-N-propan-2-yl-5-(2,4,4-trimethylpentan-2-yl)undecan-2-amine |
| SMILES | CCC(C)CC(C)(C)C(CC)C(C(C)(C)CC(C)(C)C)C(C)(C)CC(C)(C)NC(C)C |
| InChI | InChI=1S/C30H63N/c1-17-23(5)19-27(9,10)24(18-2)25(28(11,12)20-26(6,7)8)29(13,14)21-30(15,16)31-22(3)4/h22-25,31H,17-21H2,1-16H3 |
| InChIKey | UBTAGWXNHBBPOT-UHFFFAOYSA-N |
| XLogP | 9.75 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.84 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |