C22H47N3O — CID 155175016
N,N-bis[2,4-dimethyl-4-(propan-2-ylamino)pentan-2-yl]acetamide (PubChem CID 155175016) has the molecular formula C22H47N3O and a molecular weight of 369.64 g/mol. Its IUPAC name is N,N-bis[2,4-dimethyl-4-(propan-2-ylamino)pentan-2-yl]acetamide.
| Compound Name | N,N-bis[2,4-dimethyl-4-(propan-2-ylamino)pentan-2-yl]acetamide |
|---|---|
| PubChem CID | 155175016 |
| Molecular Formula | C22H47N3O |
| Molecular Weight | 369.64 g/mol |
| Exact Mass | 369.37 |
| IUPAC Name | N,N-bis[2,4-dimethyl-4-(propan-2-ylamino)pentan-2-yl]acetamide |
| SMILES | CC(=O)N(C(C)(C)CC(C)(C)NC(C)C)C(C)(C)CC(C)(C)NC(C)C |
| InChI | InChI=1S/C22H47N3O/c1-16(2)23-19(6,7)14-21(10,11)25(18(5)26)22(12,13)15-20(8,9)24-17(3)4/h16-17,23-24H,14-15H2,1-13H3 |
| InChIKey | CEJIYDHYGUDOQC-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.64 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |