C20H44N2 — CID 138712839
2,3,3,5-tetramethyl-5-N-(3,3,5,5-tetramethylhexan-2-yl)hexane-2,5-diamine (PubChem CID 138712839) has the molecular formula C20H44N2 and a molecular weight of 312.59 g/mol. Its IUPAC name is 2,3,3,5-tetramethyl-5-N-(3,3,5,5-tetramethylhexan-2-yl)hexane-2,5-diamine.
| Compound Name | 2,3,3,5-tetramethyl-5-N-(3,3,5,5-tetramethylhexan-2-yl)hexane-2,5-diamine |
|---|---|
| PubChem CID | 138712839 |
| Molecular Formula | C20H44N2 |
| Molecular Weight | 312.59 g/mol |
| Exact Mass | 312.35 |
| IUPAC Name | 2,3,3,5-tetramethyl-5-N-(3,3,5,5-tetramethylhexan-2-yl)hexane-2,5-diamine |
| SMILES | CC(NC(C)(C)CC(C)(C)C(C)(C)N)C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C20H44N2/c1-15(17(5,6)13-16(2,3)4)22-19(9,10)14-18(7,8)20(11,12)21/h15,22H,13-14,21H2,1-12H3 |
| InChIKey | KRIVWCAJOGHDGM-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.59 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |