C21H45N — CID 170038627
N,2,3,3,4,6,6,8,8-nonamethyl-5-propan-2-ylnonan-2-amine (PubChem CID 170038627) has the molecular formula C21H45N and a molecular weight of 311.60 g/mol. Its IUPAC name is N,2,3,3,4,6,6,8,8-nonamethyl-5-propan-2-ylnonan-2-amine.
| Compound Name | N,2,3,3,4,6,6,8,8-nonamethyl-5-propan-2-ylnonan-2-amine |
|---|---|
| PubChem CID | 170038627 |
| Molecular Formula | C21H45N |
| Molecular Weight | 311.60 g/mol |
| Exact Mass | 311.36 |
| IUPAC Name | N,2,3,3,4,6,6,8,8-nonamethyl-5-propan-2-ylnonan-2-amine |
| SMILES | CNC(C)(C)C(C)(C)C(C)C(C(C)C)C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C21H45N/c1-15(2)17(19(7,8)14-18(4,5)6)16(3)20(9,10)21(11,12)22-13/h15-17,22H,14H2,1-13H3 |
| InChIKey | XODHLSMRJGVEFH-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.60 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |