C17H38 — CID 145376568
ethane;2,2,4,4,5,8-hexamethylnonane (PubChem CID 145376568) has the molecular formula C17H38 and a molecular weight of 242.49 g/mol. Its IUPAC name is ethane;2,2,4,4,5,8-hexamethylnonane.
| Compound Name | ethane;2,2,4,4,5,8-hexamethylnonane |
|---|---|
| PubChem CID | 145376568 |
| Molecular Formula | C17H38 |
| Molecular Weight | 242.49 g/mol |
| Exact Mass | 242.30 |
| IUPAC Name | ethane;2,2,4,4,5,8-hexamethylnonane |
| SMILES | CC.CC(C)CCC(C)C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C15H32.C2H6/c1-12(2)9-10-13(3)15(7,8)11-14(4,5)6;1-2/h12-13H,9-11H2,1-8H3;1-2H3 |
| InChIKey | MIALJVDZXATDSZ-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.49 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |