C13H28S — CID 142509004
2,3,3,4,7-pentamethyloctane-2-thiol (PubChem CID 142509004) has the molecular formula C13H28S and a molecular weight of 216.43 g/mol. Its IUPAC name is 2,3,3,4,7-pentamethyloctane-2-thiol.
| Compound Name | 2,3,3,4,7-pentamethyloctane-2-thiol |
|---|---|
| PubChem CID | 142509004 |
| Molecular Formula | C13H28S |
| Molecular Weight | 216.43 g/mol |
| Exact Mass | 216.19 |
| IUPAC Name | 2,3,3,4,7-pentamethyloctane-2-thiol |
| SMILES | CC(C)CCC(C)C(C)(C)C(C)(C)S |
| InChI | InChI=1S/C13H28S/c1-10(2)8-9-11(3)12(4,5)13(6,7)14/h10-11,14H,8-9H2,1-7H3 |
| InChIKey | DPIGGCIGWFOUBD-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.43 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|