C23H47IS2 — CID 167181551
5-(1-iodoethyl)-2,4,4,6-tetramethyl-2-(2,4,4,5-tetramethylhexan-2-yldisulfanyl)heptane (PubChem CID 167181551) has the molecular formula C23H47IS2 and a molecular weight of 514.67 g/mol. Its IUPAC name is 5-(1-iodoethyl)-2,4,4,6-tetramethyl-2-(2,4,4,5-tetramethylhexan-2-yldisulfanyl)heptane.
| Compound Name | 5-(1-iodoethyl)-2,4,4,6-tetramethyl-2-(2,4,4,5-tetramethylhexan-2-yldisulfanyl)heptane |
|---|---|
| PubChem CID | 167181551 |
| Molecular Formula | C23H47IS2 |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.22 |
| IUPAC Name | 5-(1-iodoethyl)-2,4,4,6-tetramethyl-2-(2,4,4,5-tetramethylhexan-2-yldisulfanyl)heptane |
| SMILES | CC(C)C(C(C)I)C(C)(C)CC(C)(C)SSC(C)(C)CC(C)(C)C(C)C |
| InChI | InChI=1S/C23H47IS2/c1-16(2)19(18(5)24)21(8,9)15-23(12,13)26-25-22(10,11)14-20(6,7)17(3)4/h16-19H,14-15H2,1-13H3 |
| InChIKey | BGPFBZJUWJLTFU-UHFFFAOYSA-N |
| XLogP | 9.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|