C17H37N — CID 123992733
5,5,6,7,7,9,9-heptamethyldecan-3-amine (PubChem CID 123992733) has the molecular formula C17H37N and a molecular weight of 255.49 g/mol. Its IUPAC name is 5,5,6,7,7,9,9-heptamethyldecan-3-amine.
| Compound Name | 5,5,6,7,7,9,9-heptamethyldecan-3-amine |
|---|---|
| PubChem CID | 123992733 |
| Molecular Formula | C17H37N |
| Molecular Weight | 255.49 g/mol |
| Exact Mass | 255.29 |
| IUPAC Name | 5,5,6,7,7,9,9-heptamethyldecan-3-amine |
| SMILES | CCC(N)CC(C)(C)C(C)C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C17H37N/c1-10-14(18)11-16(6,7)13(2)17(8,9)12-15(3,4)5/h13-14H,10-12,18H2,1-9H3 |
| InChIKey | CTQFPEMVECAOLG-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.49 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |