C16H36N2 — CID 130251499
2,5,5,6,9,9-hexamethyldecane-3,7-diamine (PubChem CID 130251499) has the molecular formula C16H36N2 and a molecular weight of 256.48 g/mol. Its IUPAC name is 2,5,5,6,9,9-hexamethyldecane-3,7-diamine.
| Compound Name | 2,5,5,6,9,9-hexamethyldecane-3,7-diamine |
|---|---|
| PubChem CID | 130251499 |
| Molecular Formula | C16H36N2 |
| Molecular Weight | 256.48 g/mol |
| Exact Mass | 256.29 |
| IUPAC Name | 2,5,5,6,9,9-hexamethyldecane-3,7-diamine |
| SMILES | CC(C)C(N)CC(C)(C)C(C)C(N)CC(C)(C)C |
| InChI | InChI=1S/C16H36N2/c1-11(2)13(17)10-16(7,8)12(3)14(18)9-15(4,5)6/h11-14H,9-10,17-18H2,1-8H3 |
| InChIKey | SLMZVHQWOXDNGJ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.48 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |